C11H14F3NO3 — CID 51105884
4,4-dimethyl-2,6-dioxo-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide (PubChem CID 51105884) has the molecular formula C11H14F3NO3 and a molecular weight of 265.23 g/mol. Its IUPAC name is 4,4-dimethyl-2,6-dioxo-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide.
| Compound Name | 4,4-dimethyl-2,6-dioxo-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 51105884 |
| Molecular Formula | C11H14F3NO3 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 4,4-dimethyl-2,6-dioxo-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide |
| SMILES | CC1(C)CC(=O)C(C(=O)NCC(F)(F)F)C(=O)C1 |
| InChI | InChI=1S/C11H14F3NO3/c1-10(2)3-6(16)8(7(17)4-10)9(18)15-5-11(12,13)14/h8H,3-5H2,1-2H3,(H,15,18) |
| InChIKey | BHXAFQRSFFOPST-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|