About 2-[(3-methyl-7-oxo-4-phenyl-[1,2]oxazolo[3,4-d]pyridazin-6-yl)methyl]pentanedinitrile
2-[(3-methyl-7-oxo-4-phenyl-[1,2]oxazolo[3,4-d]pyridazin-6-yl)methyl]pentanedinitrile (PubChem CID 51107481) has the molecular formula C18H15N5O2
and a molecular weight of 333.35 g/mol. Its IUPAC name is 2-[(3-methyl-7-oxo-4-phenyl-[1,2]oxazolo[3,4-d]pyridazin-6-yl)methyl]pentanedinitrile.
Molecular Properties
| Compound Name | 2-[(3-methyl-7-oxo-4-phenyl-[1,2]oxazolo[3,4-d]pyridazin-6-yl)methyl]pentanedinitrile |
| PubChem CID | 51107481 |
| Molecular Formula | C18H15N5O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 2-[(3-methyl-7-oxo-4-phenyl-[1,2]oxazolo[3,4-d]pyridazin-6-yl)methyl]pentanedinitrile |
| SMILES | Cc1onc2c(=O)n(CC(C#N)CCC#N)nc(-c3ccccc3)c12 |
| InChI | InChI=1S/C18H15N5O2/c1-12-15-16(14-7-3-2-4-8-14)21-23(18(24)17(15)22-25-12)11-13(10-20)6-5-9-19/h2-4,7-8,13H,5-6,11H2,1H3 |
| InChIKey | OUEVGAVWBPSKKY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 108.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[(3-methyl-7-oxo-4-phenyl-[1,2]oxazolo[3,4-d]pyridazin-6-yl)methyl]pentanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-methyl-7-oxo-4-phenyl-[1,2]oxazolo[3,4-d]pyridazin-6-yl)methyl]pentanedinitrile?
The IUPAC name of 2-[(3-methyl-7-oxo-4-phenyl-[1,2]oxazolo[3,4-d]pyridazin-6-yl)methyl]pentanedinitrile (CID 51107481) is 2-[(3-methyl-7-oxo-4-phenyl-[1,2]oxazolo[3,4-d]pyridazin-6-yl)methyl]pentanedinitrile.
What is the SMILES notation for 2-[(3-methyl-7-oxo-4-phenyl-[1,2]oxazolo[3,4-d]pyridazin-6-yl)methyl]pentanedinitrile?
The canonical SMILES for 2-[(3-methyl-7-oxo-4-phenyl-[1,2]oxazolo[3,4-d]pyridazin-6-yl)methyl]pentanedinitrile is Cc1onc2c(=O)n(CC(C#N)CCC#N)nc(-c3ccccc3)c12.
What is the InChIKey of 2-[(3-methyl-7-oxo-4-phenyl-[1,2]oxazolo[3,4-d]pyridazin-6-yl)methyl]pentanedinitrile?
The InChIKey is OUEVGAVWBPSKKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N5O2/c1-12-15-16(14-7-3-2-4-8-14)21-23(18(24)17(15)22-25-12)11-13(10-20)6-5-9-19/h2-4,7-8,13H,5-6,11H2,1H3.
What are the key properties of 2-[(3-methyl-7-oxo-4-phenyl-[1,2]oxazolo[3,4-d]pyridazin-6-yl)methyl]pentanedinitrile?
2-[(3-methyl-7-oxo-4-phenyl-[1,2]oxazolo[3,4-d]pyridazin-6-yl)methyl]pentanedinitrile has a molecular weight of 333.35 g/mol, XLogP of 2.80, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-methyl-7-oxo-4-phenyl-[1,2]oxazolo[3,4-d]pyridazin-6-yl)methyl]pentanedinitrile is sourced from PubChem (CID 51107481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).