C13H15N5O — CID 51107519
N-(cyclobutylmethyl)-6-imidazol-1-ylpyridazine-3-carboxamide (PubChem CID 51107519) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-6-imidazol-1-ylpyridazine-3-carboxamide.
| Compound Name | N-(cyclobutylmethyl)-6-imidazol-1-ylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 51107519 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | N-(cyclobutylmethyl)-6-imidazol-1-ylpyridazine-3-carboxamide |
| SMILES | O=C(NCC1CCC1)c1ccc(-n2ccnc2)nn1 |
| InChI | InChI=1S/C13H15N5O/c19-13(15-8-10-2-1-3-10)11-4-5-12(17-16-11)18-7-6-14-9-18/h4-7,9-10H,1-3,8H2,(H,15,19) |
| InChIKey | YAVNZPHGORTFAO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |