About 2-cyano-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide
2-cyano-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide (PubChem CID 51107966) has the molecular formula C16H13N3O4S
and a molecular weight of 343.36 g/mol. Its IUPAC name is 2-cyano-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 2-cyano-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide |
| PubChem CID | 51107966 |
| Molecular Formula | C16H13N3O4S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 2-cyano-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide |
| SMILES | N#Cc1ccccc1S(=O)(=O)Nc1ccccc1N1CCOC1=O |
| InChI | InChI=1S/C16H13N3O4S/c17-11-12-5-1-4-8-15(12)24(21,22)18-13-6-2-3-7-14(13)19-9-10-23-16(19)20/h1-8,18H,9-10H2 |
| InChIKey | CHLLYLSTINSTFJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyano-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide?
The IUPAC name of 2-cyano-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide (CID 51107966) is 2-cyano-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide.
What is the SMILES notation for 2-cyano-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide?
The canonical SMILES for 2-cyano-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide is N#Cc1ccccc1S(=O)(=O)Nc1ccccc1N1CCOC1=O.
What is the InChIKey of 2-cyano-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide?
The InChIKey is CHLLYLSTINSTFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3O4S/c17-11-12-5-1-4-8-15(12)24(21,22)18-13-6-2-3-7-14(13)19-9-10-23-16(19)20/h1-8,18H,9-10H2.
What are the key properties of 2-cyano-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide?
2-cyano-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide has a molecular weight of 343.36 g/mol, XLogP of 2.32, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]benzenesulfonamide is sourced from PubChem (CID 51107966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).