About 1,2-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)imidazole-4-sulfonamide
1,2-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)imidazole-4-sulfonamide (PubChem CID 51108618) has the molecular formula C9H12N4O2S2
and a molecular weight of 272.36 g/mol. Its IUPAC name is 1,2-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)imidazole-4-sulfonamide.
Molecular Properties
| Compound Name | 1,2-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)imidazole-4-sulfonamide |
| PubChem CID | 51108618 |
| Molecular Formula | C9H12N4O2S2 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 1,2-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)imidazole-4-sulfonamide |
| SMILES | Cc1cnc(NS(=O)(=O)c2cn(C)c(C)n2)s1 |
| InChI | InChI=1S/C9H12N4O2S2/c1-6-4-10-9(16-6)12-17(14,15)8-5-13(3)7(2)11-8/h4-5H,1-3H3,(H,10,12) |
| InChIKey | BPFRTNVHKXCYFV-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,2-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)imidazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)imidazole-4-sulfonamide?
The IUPAC name of 1,2-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)imidazole-4-sulfonamide (CID 51108618) is 1,2-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)imidazole-4-sulfonamide.
What is the SMILES notation for 1,2-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)imidazole-4-sulfonamide?
The canonical SMILES for 1,2-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)imidazole-4-sulfonamide is Cc1cnc(NS(=O)(=O)c2cn(C)c(C)n2)s1.
What is the InChIKey of 1,2-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)imidazole-4-sulfonamide?
The InChIKey is BPFRTNVHKXCYFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O2S2/c1-6-4-10-9(16-6)12-17(14,15)8-5-13(3)7(2)11-8/h4-5H,1-3H3,(H,10,12).
What are the key properties of 1,2-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)imidazole-4-sulfonamide?
1,2-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)imidazole-4-sulfonamide has a molecular weight of 272.36 g/mol, XLogP of 1.29, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)imidazole-4-sulfonamide is sourced from PubChem (CID 51108618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).