C21H22F3N3O5S — CID 5110945
N-cyclopentyl-2-[N-(4-methyl-3-nitrophenyl)sulfonyl-3-(trifluoromethyl)anilino]acetamide (PubChem CID 5110945) has the molecular formula C21H22F3N3O5S and a molecular weight of 485.48 g/mol. Its IUPAC name is N-cyclopentyl-2-[N-(4-methyl-3-nitrophenyl)sulfonyl-3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-cyclopentyl-2-[N-(4-methyl-3-nitrophenyl)sulfonyl-3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 5110945 |
| Molecular Formula | C21H22F3N3O5S |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | N-cyclopentyl-2-[N-(4-methyl-3-nitrophenyl)sulfonyl-3-(trifluoromethyl)anilino]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NC2CCCC2)c2cccc(C(F)(F)F)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H22F3N3O5S/c1-14-9-10-18(12-19(14)27(29)30)33(31,32)26(13-20(28)25-16-6-2-3-7-16)17-8-4-5-15(11-17)21(22,23)24/h4-5,8-12,16H,2-3,6-7,13H2,1H3,(H,25,28) |
| InChIKey | VRSOHJATZFICJA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|