C29H31ClN4O4 — CID 511101
(2S)-2-[(3aS,6S,6aR)-4-(cyclopropanecarbonyl)-6-methyl-5-oxo-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carbonyl]-N-[4-(4-chlorophenyl)phenyl]pyrrolidine-1-carboxamide (PubChem CID 511101) has the molecular formula C29H31ClN4O4 and a molecular weight of 535.04 g/mol. Its IUPAC name is (2S)-2-[(3aS,6S,6aR)-4-(cyclopropanecarbonyl)-6-methyl-5-oxo-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carbonyl]-N-[4-(4-chlorophenyl)phenyl]pyrrolidine-1-carboxamide.
| Compound Name | (2S)-2-[(3aS,6S,6aR)-4-(cyclopropanecarbonyl)-6-methyl-5-oxo-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carbonyl]-N-[4-(4-chlorophenyl)phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 511101 |
| Molecular Formula | C29H31ClN4O4 |
| Molecular Weight | 535.04 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | (2S)-2-[(3aS,6S,6aR)-4-(cyclopropanecarbonyl)-6-methyl-5-oxo-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carbonyl]-N-[4-(4-chlorophenyl)phenyl]pyrrolidine-1-carboxamide |
| SMILES | C[C@@H]1C(=O)N(C(=O)C2CC2)[C@H]2CCN(C(=O)[C@@H]3CCCN3C(=O)Nc3ccc(-c4ccc(Cl)cc4)cc3)[C@H]12 |
| InChI | InChI=1S/C29H31ClN4O4/c1-17-25-23(34(26(17)35)27(36)20-4-5-20)14-16-33(25)28(37)24-3-2-15-32(24)29(38)31-22-12-8-19(9-13-22)18-6-10-21(30)11-7-18/h6-13,17,20,23-25H,2-5,14-16H2,1H3,(H,31,38)/t17-,23-,24-,25+/m0/s1 |
| InChIKey | FDZJCEDCYMJMPU-YZEFDVQJSA-N |
| XLogP | 4.39 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.04 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|