About N'-[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]cyclopropanecarbohydrazide
N'-[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]cyclopropanecarbohydrazide (PubChem CID 51110368) has the molecular formula C9H13N3O3S
and a molecular weight of 243.29 g/mol. Its IUPAC name is N'-[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]cyclopropanecarbohydrazide.
Molecular Properties
| Compound Name | N'-[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]cyclopropanecarbohydrazide |
| PubChem CID | 51110368 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | N'-[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]cyclopropanecarbohydrazide |
| SMILES | O=C(CN1CSCC1=O)NNC(=O)C1CC1 |
| InChI | InChI=1S/C9H13N3O3S/c13-7(3-12-5-16-4-8(12)14)10-11-9(15)6-1-2-6/h6H,1-5H2,(H,10,13)(H,11,15) |
| InChIKey | PTMQKWJXRUTFRB-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]cyclopropanecarbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]cyclopropanecarbohydrazide?
The IUPAC name of N'-[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]cyclopropanecarbohydrazide (CID 51110368) is N'-[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]cyclopropanecarbohydrazide.
What is the SMILES notation for N'-[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]cyclopropanecarbohydrazide?
The canonical SMILES for N'-[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]cyclopropanecarbohydrazide is O=C(CN1CSCC1=O)NNC(=O)C1CC1.
What is the InChIKey of N'-[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]cyclopropanecarbohydrazide?
The InChIKey is PTMQKWJXRUTFRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O3S/c13-7(3-12-5-16-4-8(12)14)10-11-9(15)6-1-2-6/h6H,1-5H2,(H,10,13)(H,11,15).
What are the key properties of N'-[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]cyclopropanecarbohydrazide?
N'-[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]cyclopropanecarbohydrazide has a molecular weight of 243.29 g/mol, XLogP of -0.92, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]cyclopropanecarbohydrazide is sourced from PubChem (CID 51110368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).