C18H29N3O3 — CID 51110425
ethyl 4-[2-[cyclohexen-1-yl(cyclopropyl)amino]-2-oxoethyl]piperazine-1-carboxylate (PubChem CID 51110425) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is ethyl 4-[2-[cyclohexen-1-yl(cyclopropyl)amino]-2-oxoethyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[cyclohexen-1-yl(cyclopropyl)amino]-2-oxoethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 51110425 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | ethyl 4-[2-[cyclohexen-1-yl(cyclopropyl)amino]-2-oxoethyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CC(=O)N(C2=CCCCC2)C2CC2)CC1 |
| InChI | InChI=1S/C18H29N3O3/c1-2-24-18(23)20-12-10-19(11-13-20)14-17(22)21(16-8-9-16)15-6-4-3-5-7-15/h6,16H,2-5,7-14H2,1H3 |
| InChIKey | XJLMZSRTDUPFKQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |