C25H33N5O4S — CID 51110963
N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-N-butyl-2-[4-methoxy-N-(thiophen-2-ylmethyl)anilino]acetamide (PubChem CID 51110963) has the molecular formula C25H33N5O4S and a molecular weight of 499.64 g/mol. Its IUPAC name is N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-N-butyl-2-[4-methoxy-N-(thiophen-2-ylmethyl)anilino]acetamide.
| Compound Name | N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-N-butyl-2-[4-methoxy-N-(thiophen-2-ylmethyl)anilino]acetamide |
|---|---|
| PubChem CID | 51110963 |
| Molecular Formula | C25H33N5O4S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-N-butyl-2-[4-methoxy-N-(thiophen-2-ylmethyl)anilino]acetamide |
| SMILES | CCCCN(C(=O)CN(Cc1cccs1)c1ccc(OC)cc1)c1c(N)n(CCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H33N5O4S/c1-4-6-14-29(22-23(26)30(13-5-2)25(33)27-24(22)32)21(31)17-28(16-20-8-7-15-35-20)18-9-11-19(34-3)12-10-18/h7-12,15H,4-6,13-14,16-17,26H2,1-3H3,(H,27,32,33) |
| InChIKey | OITDAMRZZVVRGZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 113.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|