C16H16N4O4S2 — CID 51111026
2-(8-methyl-4-oxoquinazolin-3-yl)-N-[(5-sulfamoylthiophen-2-yl)methyl]acetamide (PubChem CID 51111026) has the molecular formula C16H16N4O4S2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 2-(8-methyl-4-oxoquinazolin-3-yl)-N-[(5-sulfamoylthiophen-2-yl)methyl]acetamide.
| Compound Name | 2-(8-methyl-4-oxoquinazolin-3-yl)-N-[(5-sulfamoylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 51111026 |
| Molecular Formula | C16H16N4O4S2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 2-(8-methyl-4-oxoquinazolin-3-yl)-N-[(5-sulfamoylthiophen-2-yl)methyl]acetamide |
| SMILES | Cc1cccc2c(=O)n(CC(=O)NCc3ccc(S(N)(=O)=O)s3)cnc12 |
| InChI | InChI=1S/C16H16N4O4S2/c1-10-3-2-4-12-15(10)19-9-20(16(12)22)8-13(21)18-7-11-5-6-14(25-11)26(17,23)24/h2-6,9H,7-8H2,1H3,(H,18,21)(H2,17,23,24) |
| InChIKey | LWYOVPPBVLNQCH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |