C24H30N4O3S — CID 51111573
N'-[4-(4-propan-2-ylphenyl)sulfonylphenyl]-3-(1,3,5-trimethylpyrazol-4-yl)propanehydrazide (PubChem CID 51111573) has the molecular formula C24H30N4O3S and a molecular weight of 454.60 g/mol. Its IUPAC name is N'-[4-(4-propan-2-ylphenyl)sulfonylphenyl]-3-(1,3,5-trimethylpyrazol-4-yl)propanehydrazide.
| Compound Name | N'-[4-(4-propan-2-ylphenyl)sulfonylphenyl]-3-(1,3,5-trimethylpyrazol-4-yl)propanehydrazide |
|---|---|
| PubChem CID | 51111573 |
| Molecular Formula | C24H30N4O3S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | N'-[4-(4-propan-2-ylphenyl)sulfonylphenyl]-3-(1,3,5-trimethylpyrazol-4-yl)propanehydrazide |
| SMILES | Cc1nn(C)c(C)c1CCC(=O)NNc1ccc(S(=O)(=O)c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H30N4O3S/c1-16(2)19-6-10-21(11-7-19)32(30,31)22-12-8-20(9-13-22)25-26-24(29)15-14-23-17(3)27-28(5)18(23)4/h6-13,16,25H,14-15H2,1-5H3,(H,26,29) |
| InChIKey | LVNYORXTCXBGLS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|