C18H21FN2O3S — CID 51112500
1-(4-fluorophenyl)-2,5-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)pyrrole-3-carboxamide (PubChem CID 51112500) has the molecular formula C18H21FN2O3S and a molecular weight of 364.44 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2,5-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)pyrrole-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-2,5-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 51112500 |
| Molecular Formula | C18H21FN2O3S |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 1-(4-fluorophenyl)-2,5-dimethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC2(C)CCS(=O)(=O)C2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H21FN2O3S/c1-12-10-16(13(2)21(12)15-6-4-14(19)5-7-15)17(22)20-18(3)8-9-25(23,24)11-18/h4-7,10H,8-9,11H2,1-3H3,(H,20,22) |
| InChIKey | PTZQUFHIPADLQV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|