About N-(2,3-dihydro-1H-inden-1-yl)-N-methyl-3-nitroimidazo[1,2-a]pyridin-2-amine
N-(2,3-dihydro-1H-inden-1-yl)-N-methyl-3-nitroimidazo[1,2-a]pyridin-2-amine (PubChem CID 51112547) has the molecular formula C17H16N4O2
and a molecular weight of 308.34 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-1-yl)-N-methyl-3-nitroimidazo[1,2-a]pyridin-2-amine.
Molecular Properties
| Compound Name | N-(2,3-dihydro-1H-inden-1-yl)-N-methyl-3-nitroimidazo[1,2-a]pyridin-2-amine |
| PubChem CID | 51112547 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-1-yl)-N-methyl-3-nitroimidazo[1,2-a]pyridin-2-amine |
| SMILES | CN(c1nc2ccccn2c1[N+](=O)[O-])C1CCc2ccccc21 |
| InChI | InChI=1S/C17H16N4O2/c1-19(14-10-9-12-6-2-3-7-13(12)14)16-17(21(22)23)20-11-5-4-8-15(20)18-16/h2-8,11,14H,9-10H2,1H3 |
| InChIKey | RQJLVFHWOFLEMB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2,3-dihydro-1H-inden-1-yl)-N-methyl-3-nitroimidazo[1,2-a]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydro-1H-inden-1-yl)-N-methyl-3-nitroimidazo[1,2-a]pyridin-2-amine?
The IUPAC name of N-(2,3-dihydro-1H-inden-1-yl)-N-methyl-3-nitroimidazo[1,2-a]pyridin-2-amine (CID 51112547) is N-(2,3-dihydro-1H-inden-1-yl)-N-methyl-3-nitroimidazo[1,2-a]pyridin-2-amine.
What is the SMILES notation for N-(2,3-dihydro-1H-inden-1-yl)-N-methyl-3-nitroimidazo[1,2-a]pyridin-2-amine?
The canonical SMILES for N-(2,3-dihydro-1H-inden-1-yl)-N-methyl-3-nitroimidazo[1,2-a]pyridin-2-amine is CN(c1nc2ccccn2c1[N+](=O)[O-])C1CCc2ccccc21.
What is the InChIKey of N-(2,3-dihydro-1H-inden-1-yl)-N-methyl-3-nitroimidazo[1,2-a]pyridin-2-amine?
The InChIKey is RQJLVFHWOFLEMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O2/c1-19(14-10-9-12-6-2-3-7-13(12)14)16-17(21(22)23)20-11-5-4-8-15(20)18-16/h2-8,11,14H,9-10H2,1H3.
What are the key properties of N-(2,3-dihydro-1H-inden-1-yl)-N-methyl-3-nitroimidazo[1,2-a]pyridin-2-amine?
N-(2,3-dihydro-1H-inden-1-yl)-N-methyl-3-nitroimidazo[1,2-a]pyridin-2-amine has a molecular weight of 308.34 g/mol, XLogP of 3.37, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydro-1H-inden-1-yl)-N-methyl-3-nitroimidazo[1,2-a]pyridin-2-amine is sourced from PubChem (CID 51112547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).