C19H19N3O2 — CID 51112549
N'-methyl-2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)-N'-phenylacetohydrazide (PubChem CID 51112549) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is N'-methyl-2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)-N'-phenylacetohydrazide.
| Compound Name | N'-methyl-2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)-N'-phenylacetohydrazide |
|---|---|
| PubChem CID | 51112549 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N'-methyl-2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)-N'-phenylacetohydrazide |
| SMILES | Cc1oc(-c2ccccc2)nc1CC(=O)NN(C)c1ccccc1 |
| InChI | InChI=1S/C19H19N3O2/c1-14-17(20-19(24-14)15-9-5-3-6-10-15)13-18(23)21-22(2)16-11-7-4-8-12-16/h3-12H,13H2,1-2H3,(H,21,23) |
| InChIKey | RJAYRMKDRIZPTP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|