C21H20N4O5S — CID 51112856
1-[[2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetyl]amino]-3-[(4-methoxyphenyl)methyl]urea (PubChem CID 51112856) has the molecular formula C21H20N4O5S and a molecular weight of 440.48 g/mol. Its IUPAC name is 1-[[2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetyl]amino]-3-[(4-methoxyphenyl)methyl]urea.
| Compound Name | 1-[[2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetyl]amino]-3-[(4-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 51112856 |
| Molecular Formula | C21H20N4O5S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 1-[[2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetyl]amino]-3-[(4-methoxyphenyl)methyl]urea |
| SMILES | COc1ccc(CNC(=O)NNC(=O)CN2c3cccc4cccc(c34)S2(=O)=O)cc1 |
| InChI | InChI=1S/C21H20N4O5S/c1-30-16-10-8-14(9-11-16)12-22-21(27)24-23-19(26)13-25-17-6-2-4-15-5-3-7-18(20(15)17)31(25,28)29/h2-11H,12-13H2,1H3,(H,23,26)(H2,22,24,27) |
| InChIKey | TYPVCBBMWPBVOQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|