C20H20N4O4 — CID 51112941
N-(2-benzyl-5-methylpyrazol-3-yl)-4-ethoxy-3-nitrobenzamide (PubChem CID 51112941) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is N-(2-benzyl-5-methylpyrazol-3-yl)-4-ethoxy-3-nitrobenzamide.
| Compound Name | N-(2-benzyl-5-methylpyrazol-3-yl)-4-ethoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 51112941 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-(2-benzyl-5-methylpyrazol-3-yl)-4-ethoxy-3-nitrobenzamide |
| SMILES | CCOc1ccc(C(=O)Nc2cc(C)nn2Cc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20N4O4/c1-3-28-18-10-9-16(12-17(18)24(26)27)20(25)21-19-11-14(2)22-23(19)13-15-7-5-4-6-8-15/h4-12H,3,13H2,1-2H3,(H,21,25) |
| InChIKey | NNLRROAAGDJYRW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|