About 3-phenyl-N'-pyrimidin-2-yl-2,1-benzoxazole-5-carbohydrazide
3-phenyl-N'-pyrimidin-2-yl-2,1-benzoxazole-5-carbohydrazide (PubChem CID 51113177) has the molecular formula C18H13N5O2
and a molecular weight of 331.34 g/mol. Its IUPAC name is 3-phenyl-N'-pyrimidin-2-yl-2,1-benzoxazole-5-carbohydrazide.
Molecular Properties
| Compound Name | 3-phenyl-N'-pyrimidin-2-yl-2,1-benzoxazole-5-carbohydrazide |
| PubChem CID | 51113177 |
| Molecular Formula | C18H13N5O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 3-phenyl-N'-pyrimidin-2-yl-2,1-benzoxazole-5-carbohydrazide |
| SMILES | O=C(NNc1ncccn1)c1ccc2noc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C18H13N5O2/c24-17(21-22-18-19-9-4-10-20-18)13-7-8-15-14(11-13)16(25-23-15)12-5-2-1-3-6-12/h1-11H,(H,21,24)(H,19,20,22) |
| InChIKey | VCTYBRVBLHHPAB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyl-N'-pyrimidin-2-yl-2,1-benzoxazole-5-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-N'-pyrimidin-2-yl-2,1-benzoxazole-5-carbohydrazide?
The IUPAC name of 3-phenyl-N'-pyrimidin-2-yl-2,1-benzoxazole-5-carbohydrazide (CID 51113177) is 3-phenyl-N'-pyrimidin-2-yl-2,1-benzoxazole-5-carbohydrazide.
What is the SMILES notation for 3-phenyl-N'-pyrimidin-2-yl-2,1-benzoxazole-5-carbohydrazide?
The canonical SMILES for 3-phenyl-N'-pyrimidin-2-yl-2,1-benzoxazole-5-carbohydrazide is O=C(NNc1ncccn1)c1ccc2noc(-c3ccccc3)c2c1.
What is the InChIKey of 3-phenyl-N'-pyrimidin-2-yl-2,1-benzoxazole-5-carbohydrazide?
The InChIKey is VCTYBRVBLHHPAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N5O2/c24-17(21-22-18-19-9-4-10-20-18)13-7-8-15-14(11-13)16(25-23-15)12-5-2-1-3-6-12/h1-11H,(H,21,24)(H,19,20,22).
What are the key properties of 3-phenyl-N'-pyrimidin-2-yl-2,1-benzoxazole-5-carbohydrazide?
3-phenyl-N'-pyrimidin-2-yl-2,1-benzoxazole-5-carbohydrazide has a molecular weight of 331.34 g/mol, XLogP of 3.04, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-N'-pyrimidin-2-yl-2,1-benzoxazole-5-carbohydrazide is sourced from PubChem (CID 51113177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).