C21H26N2O3S — CID 51113195
(E)-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-[(1,1-dioxothiolan-3-yl)methyl]prop-2-enamide (PubChem CID 51113195) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is (E)-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-[(1,1-dioxothiolan-3-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-[(1,1-dioxothiolan-3-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 51113195 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (E)-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-[(1,1-dioxothiolan-3-yl)methyl]prop-2-enamide |
| SMILES | Cc1ccc(-n2c(C)cc(/C=C/C(=O)NCC3CCS(=O)(=O)C3)c2C)cc1 |
| InChI | InChI=1S/C21H26N2O3S/c1-15-4-7-20(8-5-15)23-16(2)12-19(17(23)3)6-9-21(24)22-13-18-10-11-27(25,26)14-18/h4-9,12,18H,10-11,13-14H2,1-3H3,(H,22,24)/b9-6+ |
| InChIKey | POIRQXBSVHGWGH-RMKNXTFCSA-N |
| XLogP | 2.97 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|