C16H22N4OS — CID 51113306
3-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]-N-propan-2-ylpropanamide (PubChem CID 51113306) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is 3-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]-N-propan-2-ylpropanamide.
| Compound Name | 3-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 51113306 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 3-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]-N-propan-2-ylpropanamide |
| SMILES | Cc1nc(NCCC(=O)NC(C)C)c2c3c(sc2n1)CCC3 |
| InChI | InChI=1S/C16H22N4OS/c1-9(2)18-13(21)7-8-17-15-14-11-5-4-6-12(11)22-16(14)20-10(3)19-15/h9H,4-8H2,1-3H3,(H,18,21)(H,17,19,20) |
| InChIKey | OSVQGKWLTUISCY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |