C17H13F3N2O2S — CID 51113674
3-methyl-N-phenylmethoxy-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 51113674) has the molecular formula C17H13F3N2O2S and a molecular weight of 366.36 g/mol. Its IUPAC name is 3-methyl-N-phenylmethoxy-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-methyl-N-phenylmethoxy-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 51113674 |
| Molecular Formula | C17H13F3N2O2S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 3-methyl-N-phenylmethoxy-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1c(C(=O)NOCc2ccccc2)sc2nc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C17H13F3N2O2S/c1-10-12-7-8-13(17(18,19)20)21-16(12)25-14(10)15(23)22-24-9-11-5-3-2-4-6-11/h2-8H,9H2,1H3,(H,22,23) |
| InChIKey | HPPSTXLURIHFRD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|