C24H20N4O2 — CID 51114372
N-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylphenyl]-2,3-dimethyl-1H-indole-5-carboxamide (PubChem CID 51114372) has the molecular formula C24H20N4O2 and a molecular weight of 396.45 g/mol. Its IUPAC name is N-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylphenyl]-2,3-dimethyl-1H-indole-5-carboxamide.
| Compound Name | N-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylphenyl]-2,3-dimethyl-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 51114372 |
| Molecular Formula | C24H20N4O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylphenyl]-2,3-dimethyl-1H-indole-5-carboxamide |
| SMILES | Cc1cc(Oc2ncccc2C#N)ccc1NC(=O)c1ccc2[nH]c(C)c(C)c2c1 |
| InChI | InChI=1S/C24H20N4O2/c1-14-11-19(30-24-18(13-25)5-4-10-26-24)7-9-21(14)28-23(29)17-6-8-22-20(12-17)15(2)16(3)27-22/h4-12,27H,1-3H3,(H,28,29) |
| InChIKey | LLICDJXMEKWTES-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|