About N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-[2-(pyridin-2-ylmethyl)-1,3-thiazol-4-yl]acetamide
N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-[2-(pyridin-2-ylmethyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 51114606) has the molecular formula C18H22N4O2S
and a molecular weight of 358.47 g/mol. Its IUPAC name is N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-[2-(pyridin-2-ylmethyl)-1,3-thiazol-4-yl]acetamide.
Molecular Properties
| Compound Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-[2-(pyridin-2-ylmethyl)-1,3-thiazol-4-yl]acetamide |
| PubChem CID | 51114606 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-[2-(pyridin-2-ylmethyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | O=C(Cc1csc(Cc2ccccn2)n1)NCCCN1CCCC1=O |
| InChI | InChI=1S/C18H22N4O2S/c23-16(20-8-4-10-22-9-3-6-18(22)24)11-15-13-25-17(21-15)12-14-5-1-2-7-19-14/h1-2,5,7,13H,3-4,6,8-12H2,(H,20,23) |
| InChIKey | IIQHLRJYEVTGMX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-[2-(pyridin-2-ylmethyl)-1,3-thiazol-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-[2-(pyridin-2-ylmethyl)-1,3-thiazol-4-yl]acetamide?
The IUPAC name of N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-[2-(pyridin-2-ylmethyl)-1,3-thiazol-4-yl]acetamide (CID 51114606) is N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-[2-(pyridin-2-ylmethyl)-1,3-thiazol-4-yl]acetamide.
What is the SMILES notation for N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-[2-(pyridin-2-ylmethyl)-1,3-thiazol-4-yl]acetamide?
The canonical SMILES for N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-[2-(pyridin-2-ylmethyl)-1,3-thiazol-4-yl]acetamide is O=C(Cc1csc(Cc2ccccn2)n1)NCCCN1CCCC1=O.
What is the InChIKey of N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-[2-(pyridin-2-ylmethyl)-1,3-thiazol-4-yl]acetamide?
The InChIKey is IIQHLRJYEVTGMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O2S/c23-16(20-8-4-10-22-9-3-6-18(22)24)11-15-13-25-17(21-15)12-14-5-1-2-7-19-14/h1-2,5,7,13H,3-4,6,8-12H2,(H,20,23).
What are the key properties of N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-[2-(pyridin-2-ylmethyl)-1,3-thiazol-4-yl]acetamide?
N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-[2-(pyridin-2-ylmethyl)-1,3-thiazol-4-yl]acetamide has a molecular weight of 358.47 g/mol, XLogP of 1.80, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-[2-(pyridin-2-ylmethyl)-1,3-thiazol-4-yl]acetamide is sourced from PubChem (CID 51114606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).