C20H18N4O3 — CID 51114715
4-cyano-2-methyl-N-[2-methyl-3-(methylcarbamoyl)phenyl]-5-pyrrol-1-ylfuran-3-carboxamide (PubChem CID 51114715) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is 4-cyano-2-methyl-N-[2-methyl-3-(methylcarbamoyl)phenyl]-5-pyrrol-1-ylfuran-3-carboxamide.
| Compound Name | 4-cyano-2-methyl-N-[2-methyl-3-(methylcarbamoyl)phenyl]-5-pyrrol-1-ylfuran-3-carboxamide |
|---|---|
| PubChem CID | 51114715 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 4-cyano-2-methyl-N-[2-methyl-3-(methylcarbamoyl)phenyl]-5-pyrrol-1-ylfuran-3-carboxamide |
| SMILES | CNC(=O)c1cccc(NC(=O)c2c(C)oc(-n3cccc3)c2C#N)c1C |
| InChI | InChI=1S/C20H18N4O3/c1-12-14(18(25)22-3)7-6-8-16(12)23-19(26)17-13(2)27-20(15(17)11-21)24-9-4-5-10-24/h4-10H,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | FEBADKYCUCWWGV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 100.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_F(5)', 'substructure': 'N/A'} |
|---|