C20H19F2NOS — CID 51114899
1-(3-fluoro-4-methoxyphenyl)-N-[[5-(2-fluorophenyl)thiophen-2-yl]methyl]ethanamine (PubChem CID 51114899) has the molecular formula C20H19F2NOS and a molecular weight of 359.44 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)-N-[[5-(2-fluorophenyl)thiophen-2-yl]methyl]ethanamine.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)-N-[[5-(2-fluorophenyl)thiophen-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 51114899 |
| Molecular Formula | C20H19F2NOS |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)-N-[[5-(2-fluorophenyl)thiophen-2-yl]methyl]ethanamine |
| SMILES | COc1ccc(C(C)NCc2ccc(-c3ccccc3F)s2)cc1F |
| InChI | InChI=1S/C20H19F2NOS/c1-13(14-7-9-19(24-2)18(22)11-14)23-12-15-8-10-20(25-15)16-5-3-4-6-17(16)21/h3-11,13,23H,12H2,1-2H3 |
| InChIKey | HYRMNTFSXCWSBC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |