About 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-(3-methylpiperidin-1-yl)propyl]propanamide
3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-(3-methylpiperidin-1-yl)propyl]propanamide (PubChem CID 51115786) has the molecular formula C16H27N3O2S
and a molecular weight of 325.48 g/mol. Its IUPAC name is 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-(3-methylpiperidin-1-yl)propyl]propanamide.
Molecular Properties
| Compound Name | 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-(3-methylpiperidin-1-yl)propyl]propanamide |
| PubChem CID | 51115786 |
| Molecular Formula | C16H27N3O2S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-(3-methylpiperidin-1-yl)propyl]propanamide |
| SMILES | Cc1csc(=O)n1CCC(=O)NCC(C)N1CCCC(C)C1 |
| InChI | InChI=1S/C16H27N3O2S/c1-12-5-4-7-18(10-12)13(2)9-17-15(20)6-8-19-14(3)11-22-16(19)21/h11-13H,4-10H2,1-3H3,(H,17,20) |
| InChIKey | NJVIIPLICRCKDS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-(3-methylpiperidin-1-yl)propyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-(3-methylpiperidin-1-yl)propyl]propanamide?
The IUPAC name of 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-(3-methylpiperidin-1-yl)propyl]propanamide (CID 51115786) is 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-(3-methylpiperidin-1-yl)propyl]propanamide.
What is the SMILES notation for 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-(3-methylpiperidin-1-yl)propyl]propanamide?
The canonical SMILES for 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-(3-methylpiperidin-1-yl)propyl]propanamide is Cc1csc(=O)n1CCC(=O)NCC(C)N1CCCC(C)C1.
What is the InChIKey of 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-(3-methylpiperidin-1-yl)propyl]propanamide?
The InChIKey is NJVIIPLICRCKDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N3O2S/c1-12-5-4-7-18(10-12)13(2)9-17-15(20)6-8-19-14(3)11-22-16(19)21/h11-13H,4-10H2,1-3H3,(H,17,20).
What are the key properties of 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-(3-methylpiperidin-1-yl)propyl]propanamide?
3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-(3-methylpiperidin-1-yl)propyl]propanamide has a molecular weight of 325.48 g/mol, XLogP of 1.84, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-(3-methylpiperidin-1-yl)propyl]propanamide is sourced from PubChem (CID 51115786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).