About methyl 2-[(1-methyl-2,6-dioxo-3,7-dihydropurin-8-yl)sulfanyl]propanoate
methyl 2-[(1-methyl-2,6-dioxo-3,7-dihydropurin-8-yl)sulfanyl]propanoate (PubChem CID 5111684) has the molecular formula C10H12N4O4S
and a molecular weight of 284.30 g/mol. Its IUPAC name is methyl 2-[(1-methyl-2,6-dioxo-3,7-dihydropurin-8-yl)sulfanyl]propanoate.
Molecular Properties
| Compound Name | methyl 2-[(1-methyl-2,6-dioxo-3,7-dihydropurin-8-yl)sulfanyl]propanoate |
| PubChem CID | 5111684 |
| Molecular Formula | C10H12N4O4S |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | methyl 2-[(1-methyl-2,6-dioxo-3,7-dihydropurin-8-yl)sulfanyl]propanoate |
| SMILES | COC(=O)C(C)Sc1nc2[nH]c(=O)n(C)c(=O)c2[nH]1 |
| InChI | InChI=1S/C10H12N4O4S/c1-4(8(16)18-3)19-9-11-5-6(12-9)13-10(17)14(2)7(5)15/h4H,1-3H3,(H,11,12)(H,13,17) |
| InChIKey | RQPVGFCCSNJBMF-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 109.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-[(1-methyl-2,6-dioxo-3,7-dihydropurin-8-yl)sulfanyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(1-methyl-2,6-dioxo-3,7-dihydropurin-8-yl)sulfanyl]propanoate?
The IUPAC name of methyl 2-[(1-methyl-2,6-dioxo-3,7-dihydropurin-8-yl)sulfanyl]propanoate (CID 5111684) is methyl 2-[(1-methyl-2,6-dioxo-3,7-dihydropurin-8-yl)sulfanyl]propanoate.
What is the SMILES notation for methyl 2-[(1-methyl-2,6-dioxo-3,7-dihydropurin-8-yl)sulfanyl]propanoate?
The canonical SMILES for methyl 2-[(1-methyl-2,6-dioxo-3,7-dihydropurin-8-yl)sulfanyl]propanoate is COC(=O)C(C)Sc1nc2[nH]c(=O)n(C)c(=O)c2[nH]1.
What is the InChIKey of methyl 2-[(1-methyl-2,6-dioxo-3,7-dihydropurin-8-yl)sulfanyl]propanoate?
The InChIKey is RQPVGFCCSNJBMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O4S/c1-4(8(16)18-3)19-9-11-5-6(12-9)13-10(17)14(2)7(5)15/h4H,1-3H3,(H,11,12)(H,13,17).
What are the key properties of methyl 2-[(1-methyl-2,6-dioxo-3,7-dihydropurin-8-yl)sulfanyl]propanoate?
methyl 2-[(1-methyl-2,6-dioxo-3,7-dihydropurin-8-yl)sulfanyl]propanoate has a molecular weight of 284.30 g/mol, XLogP of -0.40, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1-methyl-2,6-dioxo-3,7-dihydropurin-8-yl)sulfanyl]propanoate is sourced from PubChem (CID 5111684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).