About N-[(2-hydroxy-5-nitrophenyl)methyl]-N'-isoquinolin-5-yloxamide
N-[(2-hydroxy-5-nitrophenyl)methyl]-N'-isoquinolin-5-yloxamide (PubChem CID 51116845) has the molecular formula C18H14N4O5
and a molecular weight of 366.33 g/mol. Its IUPAC name is N-[(2-hydroxy-5-nitrophenyl)methyl]-N'-isoquinolin-5-yloxamide.
Molecular Properties
| Compound Name | N-[(2-hydroxy-5-nitrophenyl)methyl]-N'-isoquinolin-5-yloxamide |
| PubChem CID | 51116845 |
| Molecular Formula | C18H14N4O5 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N-[(2-hydroxy-5-nitrophenyl)methyl]-N'-isoquinolin-5-yloxamide |
| SMILES | O=C(NCc1cc([N+](=O)[O-])ccc1O)C(=O)Nc1cccc2cnccc12 |
| InChI | InChI=1S/C18H14N4O5/c23-16-5-4-13(22(26)27)8-12(16)10-20-17(24)18(25)21-15-3-1-2-11-9-19-7-6-14(11)15/h1-9,23H,10H2,(H,20,24)(H,21,25) |
| InChIKey | KHJVIDYRFXGNEZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 134.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-hydroxy-5-nitrophenyl)methyl]-N'-isoquinolin-5-yloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-hydroxy-5-nitrophenyl)methyl]-N'-isoquinolin-5-yloxamide?
The IUPAC name of N-[(2-hydroxy-5-nitrophenyl)methyl]-N'-isoquinolin-5-yloxamide (CID 51116845) is N-[(2-hydroxy-5-nitrophenyl)methyl]-N'-isoquinolin-5-yloxamide.
What is the SMILES notation for N-[(2-hydroxy-5-nitrophenyl)methyl]-N'-isoquinolin-5-yloxamide?
The canonical SMILES for N-[(2-hydroxy-5-nitrophenyl)methyl]-N'-isoquinolin-5-yloxamide is O=C(NCc1cc([N+](=O)[O-])ccc1O)C(=O)Nc1cccc2cnccc12.
What is the InChIKey of N-[(2-hydroxy-5-nitrophenyl)methyl]-N'-isoquinolin-5-yloxamide?
The InChIKey is KHJVIDYRFXGNEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N4O5/c23-16-5-4-13(22(26)27)8-12(16)10-20-17(24)18(25)21-15-3-1-2-11-9-19-7-6-14(11)15/h1-9,23H,10H2,(H,20,24)(H,21,25).
What are the key properties of N-[(2-hydroxy-5-nitrophenyl)methyl]-N'-isoquinolin-5-yloxamide?
N-[(2-hydroxy-5-nitrophenyl)methyl]-N'-isoquinolin-5-yloxamide has a molecular weight of 366.33 g/mol, XLogP of 2.10, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-hydroxy-5-nitrophenyl)methyl]-N'-isoquinolin-5-yloxamide is sourced from PubChem (CID 51116845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).