About 1-tert-butyl-3,5-dimethyl-N-(4-methyl-3-sulfamoylphenyl)pyrazole-4-carboxamide
1-tert-butyl-3,5-dimethyl-N-(4-methyl-3-sulfamoylphenyl)pyrazole-4-carboxamide (PubChem CID 51117905) has the molecular formula C17H24N4O3S
and a molecular weight of 364.47 g/mol. Its IUPAC name is 1-tert-butyl-3,5-dimethyl-N-(4-methyl-3-sulfamoylphenyl)pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 1-tert-butyl-3,5-dimethyl-N-(4-methyl-3-sulfamoylphenyl)pyrazole-4-carboxamide |
| PubChem CID | 51117905 |
| Molecular Formula | C17H24N4O3S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 1-tert-butyl-3,5-dimethyl-N-(4-methyl-3-sulfamoylphenyl)pyrazole-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2c(C)nn(C(C)(C)C)c2C)cc1S(N)(=O)=O |
| InChI | InChI=1S/C17H24N4O3S/c1-10-7-8-13(9-14(10)25(18,23)24)19-16(22)15-11(2)20-21(12(15)3)17(4,5)6/h7-9H,1-6H3,(H,19,22)(H2,18,23,24) |
| InChIKey | NNSKEWXXSSLIQO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-tert-butyl-3,5-dimethyl-N-(4-methyl-3-sulfamoylphenyl)pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3,5-dimethyl-N-(4-methyl-3-sulfamoylphenyl)pyrazole-4-carboxamide?
The IUPAC name of 1-tert-butyl-3,5-dimethyl-N-(4-methyl-3-sulfamoylphenyl)pyrazole-4-carboxamide (CID 51117905) is 1-tert-butyl-3,5-dimethyl-N-(4-methyl-3-sulfamoylphenyl)pyrazole-4-carboxamide.
What is the SMILES notation for 1-tert-butyl-3,5-dimethyl-N-(4-methyl-3-sulfamoylphenyl)pyrazole-4-carboxamide?
The canonical SMILES for 1-tert-butyl-3,5-dimethyl-N-(4-methyl-3-sulfamoylphenyl)pyrazole-4-carboxamide is Cc1ccc(NC(=O)c2c(C)nn(C(C)(C)C)c2C)cc1S(N)(=O)=O.
What is the InChIKey of 1-tert-butyl-3,5-dimethyl-N-(4-methyl-3-sulfamoylphenyl)pyrazole-4-carboxamide?
The InChIKey is NNSKEWXXSSLIQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4O3S/c1-10-7-8-13(9-14(10)25(18,23)24)19-16(22)15-11(2)20-21(12(15)3)17(4,5)6/h7-9H,1-6H3,(H,19,22)(H2,18,23,24).
What are the key properties of 1-tert-butyl-3,5-dimethyl-N-(4-methyl-3-sulfamoylphenyl)pyrazole-4-carboxamide?
1-tert-butyl-3,5-dimethyl-N-(4-methyl-3-sulfamoylphenyl)pyrazole-4-carboxamide has a molecular weight of 364.47 g/mol, XLogP of 2.46, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3,5-dimethyl-N-(4-methyl-3-sulfamoylphenyl)pyrazole-4-carboxamide is sourced from PubChem (CID 51117905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).