C17H25N3OS — CID 51118291
N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-2-thiophen-2-ylpyrrolidine-1-carboxamide (PubChem CID 51118291) has the molecular formula C17H25N3OS and a molecular weight of 319.47 g/mol. Its IUPAC name is N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-2-thiophen-2-ylpyrrolidine-1-carboxamide.
| Compound Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-2-thiophen-2-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 51118291 |
| Molecular Formula | C17H25N3OS |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-2-thiophen-2-ylpyrrolidine-1-carboxamide |
| SMILES | O=C(NC1CCN2CCCCC12)N1CCCC1c1cccs1 |
| InChI | InChI=1S/C17H25N3OS/c21-17(18-13-8-11-19-9-2-1-5-14(13)19)20-10-3-6-15(20)16-7-4-12-22-16/h4,7,12-15H,1-3,5-6,8-11H2,(H,18,21) |
| InChIKey | WHHMVBNUQMTYDQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |