About N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]-2-(trifluoromethyl)benzenesulfonamide
N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 51118651) has the molecular formula C15H10F3N3O2S3
and a molecular weight of 417.46 g/mol. Its IUPAC name is N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]-2-(trifluoromethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]-2-(trifluoromethyl)benzenesulfonamide |
| PubChem CID | 51118651 |
| Molecular Formula | C15H10F3N3O2S3 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Sc2nncs2)cc1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H10F3N3O2S3/c16-15(17,18)12-3-1-2-4-13(12)26(22,23)21-10-5-7-11(8-6-10)25-14-20-19-9-24-14/h1-9,21H |
| InChIKey | AWDBWFGTITVHLO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]-2-(trifluoromethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]-2-(trifluoromethyl)benzenesulfonamide?
The IUPAC name of N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]-2-(trifluoromethyl)benzenesulfonamide (CID 51118651) is N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]-2-(trifluoromethyl)benzenesulfonamide.
What is the SMILES notation for N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]-2-(trifluoromethyl)benzenesulfonamide?
The canonical SMILES for N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]-2-(trifluoromethyl)benzenesulfonamide is O=S(=O)(Nc1ccc(Sc2nncs2)cc1)c1ccccc1C(F)(F)F.
What is the InChIKey of N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]-2-(trifluoromethyl)benzenesulfonamide?
The InChIKey is AWDBWFGTITVHLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F3N3O2S3/c16-15(17,18)12-3-1-2-4-13(12)26(22,23)21-10-5-7-11(8-6-10)25-14-20-19-9-24-14/h1-9,21H.
What are the key properties of N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]-2-(trifluoromethyl)benzenesulfonamide?
N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]-2-(trifluoromethyl)benzenesulfonamide has a molecular weight of 417.46 g/mol, XLogP of 4.51, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]-2-(trifluoromethyl)benzenesulfonamide is sourced from PubChem (CID 51118651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).