About ethyl N-[1-(7-fluoro-2,3-dimethylquinoxaline-5-carbonyl)piperidin-3-yl]carbamate
ethyl N-[1-(7-fluoro-2,3-dimethylquinoxaline-5-carbonyl)piperidin-3-yl]carbamate (PubChem CID 51120310) has the molecular formula C19H23FN4O3
and a molecular weight of 374.42 g/mol. Its IUPAC name is ethyl N-[1-(7-fluoro-2,3-dimethylquinoxaline-5-carbonyl)piperidin-3-yl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[1-(7-fluoro-2,3-dimethylquinoxaline-5-carbonyl)piperidin-3-yl]carbamate |
| PubChem CID | 51120310 |
| Molecular Formula | C19H23FN4O3 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | ethyl N-[1-(7-fluoro-2,3-dimethylquinoxaline-5-carbonyl)piperidin-3-yl]carbamate |
| SMILES | CCOC(=O)NC1CCCN(C(=O)c2cc(F)cc3nc(C)c(C)nc23)C1 |
| InChI | InChI=1S/C19H23FN4O3/c1-4-27-19(26)23-14-6-5-7-24(10-14)18(25)15-8-13(20)9-16-17(15)22-12(3)11(2)21-16/h8-9,14H,4-7,10H2,1-3H3,(H,23,26) |
| InChIKey | LLABOOZDNADGLX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl N-[1-(7-fluoro-2,3-dimethylquinoxaline-5-carbonyl)piperidin-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[1-(7-fluoro-2,3-dimethylquinoxaline-5-carbonyl)piperidin-3-yl]carbamate?
The IUPAC name of ethyl N-[1-(7-fluoro-2,3-dimethylquinoxaline-5-carbonyl)piperidin-3-yl]carbamate (CID 51120310) is ethyl N-[1-(7-fluoro-2,3-dimethylquinoxaline-5-carbonyl)piperidin-3-yl]carbamate.
What is the SMILES notation for ethyl N-[1-(7-fluoro-2,3-dimethylquinoxaline-5-carbonyl)piperidin-3-yl]carbamate?
The canonical SMILES for ethyl N-[1-(7-fluoro-2,3-dimethylquinoxaline-5-carbonyl)piperidin-3-yl]carbamate is CCOC(=O)NC1CCCN(C(=O)c2cc(F)cc3nc(C)c(C)nc23)C1.
What is the InChIKey of ethyl N-[1-(7-fluoro-2,3-dimethylquinoxaline-5-carbonyl)piperidin-3-yl]carbamate?
The InChIKey is LLABOOZDNADGLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23FN4O3/c1-4-27-19(26)23-14-6-5-7-24(10-14)18(25)15-8-13(20)9-16-17(15)22-12(3)11(2)21-16/h8-9,14H,4-7,10H2,1-3H3,(H,23,26).
What are the key properties of ethyl N-[1-(7-fluoro-2,3-dimethylquinoxaline-5-carbonyl)piperidin-3-yl]carbamate?
ethyl N-[1-(7-fluoro-2,3-dimethylquinoxaline-5-carbonyl)piperidin-3-yl]carbamate has a molecular weight of 374.42 g/mol, XLogP of 2.74, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[1-(7-fluoro-2,3-dimethylquinoxaline-5-carbonyl)piperidin-3-yl]carbamate is sourced from PubChem (CID 51120310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).