About morpholin-4-yl-[4-[(5-nitrothiophen-3-yl)methyl]-2,3-dihydro-1,4-benzoxazin-2-yl]methanone
morpholin-4-yl-[4-[(5-nitrothiophen-3-yl)methyl]-2,3-dihydro-1,4-benzoxazin-2-yl]methanone (PubChem CID 51120603) has the molecular formula C18H19N3O5S
and a molecular weight of 389.43 g/mol. Its IUPAC name is morpholin-4-yl-[4-[(5-nitrothiophen-3-yl)methyl]-2,3-dihydro-1,4-benzoxazin-2-yl]methanone.
Molecular Properties
| Compound Name | morpholin-4-yl-[4-[(5-nitrothiophen-3-yl)methyl]-2,3-dihydro-1,4-benzoxazin-2-yl]methanone |
| PubChem CID | 51120603 |
| Molecular Formula | C18H19N3O5S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | morpholin-4-yl-[4-[(5-nitrothiophen-3-yl)methyl]-2,3-dihydro-1,4-benzoxazin-2-yl]methanone |
| SMILES | O=C(C1CN(Cc2csc([N+](=O)[O-])c2)c2ccccc2O1)N1CCOCC1 |
| InChI | InChI=1S/C18H19N3O5S/c22-18(19-5-7-25-8-6-19)16-11-20(14-3-1-2-4-15(14)26-16)10-13-9-17(21(23)24)27-12-13/h1-4,9,12,16H,5-8,10-11H2 |
| InChIKey | ZPDBDQLFNAIIGR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze morpholin-4-yl-[4-[(5-nitrothiophen-3-yl)methyl]-2,3-dihydro-1,4-benzoxazin-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholin-4-yl-[4-[(5-nitrothiophen-3-yl)methyl]-2,3-dihydro-1,4-benzoxazin-2-yl]methanone?
The IUPAC name of morpholin-4-yl-[4-[(5-nitrothiophen-3-yl)methyl]-2,3-dihydro-1,4-benzoxazin-2-yl]methanone (CID 51120603) is morpholin-4-yl-[4-[(5-nitrothiophen-3-yl)methyl]-2,3-dihydro-1,4-benzoxazin-2-yl]methanone.
What is the SMILES notation for morpholin-4-yl-[4-[(5-nitrothiophen-3-yl)methyl]-2,3-dihydro-1,4-benzoxazin-2-yl]methanone?
The canonical SMILES for morpholin-4-yl-[4-[(5-nitrothiophen-3-yl)methyl]-2,3-dihydro-1,4-benzoxazin-2-yl]methanone is O=C(C1CN(Cc2csc([N+](=O)[O-])c2)c2ccccc2O1)N1CCOCC1.
What is the InChIKey of morpholin-4-yl-[4-[(5-nitrothiophen-3-yl)methyl]-2,3-dihydro-1,4-benzoxazin-2-yl]methanone?
The InChIKey is ZPDBDQLFNAIIGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O5S/c22-18(19-5-7-25-8-6-19)16-11-20(14-3-1-2-4-15(14)26-16)10-13-9-17(21(23)24)27-12-13/h1-4,9,12,16H,5-8,10-11H2.
What are the key properties of morpholin-4-yl-[4-[(5-nitrothiophen-3-yl)methyl]-2,3-dihydro-1,4-benzoxazin-2-yl]methanone?
morpholin-4-yl-[4-[(5-nitrothiophen-3-yl)methyl]-2,3-dihydro-1,4-benzoxazin-2-yl]methanone has a molecular weight of 389.43 g/mol, XLogP of 2.28, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-4-yl-[4-[(5-nitrothiophen-3-yl)methyl]-2,3-dihydro-1,4-benzoxazin-2-yl]methanone is sourced from PubChem (CID 51120603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).