About 2-(diethylamino)-N-[tris(dimethylamino)-λ5-phosphanylidene]-1,3-thiazole-5-carbothioamide
2-(diethylamino)-N-[tris(dimethylamino)-λ5-phosphanylidene]-1,3-thiazole-5-carbothioamide (PubChem CID 5112064) has the molecular formula C14H29N6PS2
and a molecular weight of 376.54 g/mol. Its IUPAC name is 2-(diethylamino)-N-[tris(dimethylamino)-λ5-phosphanylidene]-1,3-thiazole-5-carbothioamide.
Molecular Properties
| Compound Name | 2-(diethylamino)-N-[tris(dimethylamino)-λ5-phosphanylidene]-1,3-thiazole-5-carbothioamide |
| PubChem CID | 5112064 |
| Molecular Formula | C14H29N6PS2 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 2-(diethylamino)-N-[tris(dimethylamino)-λ5-phosphanylidene]-1,3-thiazole-5-carbothioamide |
| SMILES | CCN(CC)c1ncc(C(=S)N=P(N(C)C)(N(C)C)N(C)C)s1 |
| InChI | InChI=1S/C14H29N6PS2/c1-9-20(10-2)14-15-11-12(23-14)13(22)16-21(17(3)4,18(5)6)19(7)8/h11H,9-10H2,1-8H3 |
| InChIKey | SWBOILNPPQSBSF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)-N-[tris(dimethylamino)-λ5-phosphanylidene]-1,3-thiazole-5-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)-N-[tris(dimethylamino)-λ5-phosphanylidene]-1,3-thiazole-5-carbothioamide?
The IUPAC name of 2-(diethylamino)-N-[tris(dimethylamino)-λ5-phosphanylidene]-1,3-thiazole-5-carbothioamide (CID 5112064) is 2-(diethylamino)-N-[tris(dimethylamino)-λ5-phosphanylidene]-1,3-thiazole-5-carbothioamide.
What is the SMILES notation for 2-(diethylamino)-N-[tris(dimethylamino)-λ5-phosphanylidene]-1,3-thiazole-5-carbothioamide?
The canonical SMILES for 2-(diethylamino)-N-[tris(dimethylamino)-λ5-phosphanylidene]-1,3-thiazole-5-carbothioamide is CCN(CC)c1ncc(C(=S)N=P(N(C)C)(N(C)C)N(C)C)s1.
What is the InChIKey of 2-(diethylamino)-N-[tris(dimethylamino)-λ5-phosphanylidene]-1,3-thiazole-5-carbothioamide?
The InChIKey is SWBOILNPPQSBSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29N6PS2/c1-9-20(10-2)14-15-11-12(23-14)13(22)16-21(17(3)4,18(5)6)19(7)8/h11H,9-10H2,1-8H3.
What are the key properties of 2-(diethylamino)-N-[tris(dimethylamino)-λ5-phosphanylidene]-1,3-thiazole-5-carbothioamide?
2-(diethylamino)-N-[tris(dimethylamino)-λ5-phosphanylidene]-1,3-thiazole-5-carbothioamide has a molecular weight of 376.54 g/mol, XLogP of 3.30, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)-N-[tris(dimethylamino)-λ5-phosphanylidene]-1,3-thiazole-5-carbothioamide is sourced from PubChem (CID 5112064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).