C21H24N2O2S — CID 51121033
4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-oxo-N-(1,2,3,4-tetrahydronaphthalen-2-yl)butanamide (PubChem CID 51121033) has the molecular formula C21H24N2O2S and a molecular weight of 368.50 g/mol. Its IUPAC name is 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-oxo-N-(1,2,3,4-tetrahydronaphthalen-2-yl)butanamide.
| Compound Name | 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-oxo-N-(1,2,3,4-tetrahydronaphthalen-2-yl)butanamide |
|---|---|
| PubChem CID | 51121033 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-oxo-N-(1,2,3,4-tetrahydronaphthalen-2-yl)butanamide |
| SMILES | O=C(CCC(=O)N1CCc2sccc2C1)NC1CCc2ccccc2C1 |
| InChI | InChI=1S/C21H24N2O2S/c24-20(22-18-6-5-15-3-1-2-4-16(15)13-18)7-8-21(25)23-11-9-19-17(14-23)10-12-26-19/h1-4,10,12,18H,5-9,11,13-14H2,(H,22,24) |
| InChIKey | HCRNVVBCPGGUEJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |