C21H21F2N3O — CID 5112174
1-(2,4-difluorophenyl)-3-[(3-methoxyphenyl)methyl]-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-b]azepine (PubChem CID 5112174) has the molecular formula C21H21F2N3O and a molecular weight of 369.42 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[(3-methoxyphenyl)methyl]-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-b]azepine.
| Compound Name | 1-(2,4-difluorophenyl)-3-[(3-methoxyphenyl)methyl]-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-b]azepine |
|---|---|
| PubChem CID | 5112174 |
| Molecular Formula | C21H21F2N3O |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[(3-methoxyphenyl)methyl]-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-b]azepine |
| SMILES | COc1cccc(Cc2nn(-c3ccc(F)cc3F)c3c2CCCCN3)c1 |
| InChI | InChI=1S/C21H21F2N3O/c1-27-16-6-4-5-14(11-16)12-19-17-7-2-3-10-24-21(17)26(25-19)20-9-8-15(22)13-18(20)23/h4-6,8-9,11,13,24H,2-3,7,10,12H2,1H3 |
| InChIKey | TYSBLIBNRWFDQU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |