C20H21N3O3 — CID 51123968
N-(4-tert-butylphenyl)-N-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide (PubChem CID 51123968) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-N-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-N-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 51123968 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-(4-tert-butylphenyl)-N-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide |
| SMILES | CN(C(=O)c1ccc2[nH]c(=O)c(=O)[nH]c2c1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H21N3O3/c1-20(2,3)13-6-8-14(9-7-13)23(4)19(26)12-5-10-15-16(11-12)22-18(25)17(24)21-15/h5-11H,1-4H3,(H,21,24)(H,22,25) |
| InChIKey | JMCLTVRVZOTHOQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|