About 3-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl]thieno[3,2-d]pyrimidin-4-one
3-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl]thieno[3,2-d]pyrimidin-4-one (PubChem CID 51124152) has the molecular formula C17H13N3O2S2
and a molecular weight of 355.44 g/mol. Its IUPAC name is 3-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl]thieno[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl]thieno[3,2-d]pyrimidin-4-one |
| PubChem CID | 51124152 |
| Molecular Formula | C17H13N3O2S2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 3-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl]thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1c2sccc2ncn1Cc1csc(COc2ccccc2)n1 |
| InChI | InChI=1S/C17H13N3O2S2/c21-17-16-14(6-7-23-16)18-11-20(17)8-12-10-24-15(19-12)9-22-13-4-2-1-3-5-13/h1-7,10-11H,8-9H2 |
| InChIKey | NYCJVCOTDNEGAA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl]thieno[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl]thieno[3,2-d]pyrimidin-4-one?
The IUPAC name of 3-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl]thieno[3,2-d]pyrimidin-4-one (CID 51124152) is 3-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl]thieno[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 3-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl]thieno[3,2-d]pyrimidin-4-one?
The canonical SMILES for 3-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl]thieno[3,2-d]pyrimidin-4-one is O=c1c2sccc2ncn1Cc1csc(COc2ccccc2)n1.
What is the InChIKey of 3-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl]thieno[3,2-d]pyrimidin-4-one?
The InChIKey is NYCJVCOTDNEGAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N3O2S2/c21-17-16-14(6-7-23-16)18-11-20(17)8-12-10-24-15(19-12)9-22-13-4-2-1-3-5-13/h1-7,10-11H,8-9H2.
What are the key properties of 3-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl]thieno[3,2-d]pyrimidin-4-one?
3-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl]thieno[3,2-d]pyrimidin-4-one has a molecular weight of 355.44 g/mol, XLogP of 3.54, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl]thieno[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 51124152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).