C17H21FN2O4S — CID 51124455
2-fluoro-N-[(5-methylfuran-2-yl)methyl]-5-(methylsulfamoyl)-N-propan-2-ylbenzamide (PubChem CID 51124455) has the molecular formula C17H21FN2O4S and a molecular weight of 368.43 g/mol. Its IUPAC name is 2-fluoro-N-[(5-methylfuran-2-yl)methyl]-5-(methylsulfamoyl)-N-propan-2-ylbenzamide.
| Compound Name | 2-fluoro-N-[(5-methylfuran-2-yl)methyl]-5-(methylsulfamoyl)-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 51124455 |
| Molecular Formula | C17H21FN2O4S |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-fluoro-N-[(5-methylfuran-2-yl)methyl]-5-(methylsulfamoyl)-N-propan-2-ylbenzamide |
| SMILES | CNS(=O)(=O)c1ccc(F)c(C(=O)N(Cc2ccc(C)o2)C(C)C)c1 |
| InChI | InChI=1S/C17H21FN2O4S/c1-11(2)20(10-13-6-5-12(3)24-13)17(21)15-9-14(7-8-16(15)18)25(22,23)19-4/h5-9,11,19H,10H2,1-4H3 |
| InChIKey | XHEMIRFXVXLCTQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |