C15H12F3N3O2S2 — CID 51124557
4-[2-(1,3-thiazol-2-ylsulfanyl)propanoyl]-7-(trifluoromethyl)-1,3-dihydroquinoxalin-2-one (PubChem CID 51124557) has the molecular formula C15H12F3N3O2S2 and a molecular weight of 387.41 g/mol. Its IUPAC name is 4-[2-(1,3-thiazol-2-ylsulfanyl)propanoyl]-7-(trifluoromethyl)-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[2-(1,3-thiazol-2-ylsulfanyl)propanoyl]-7-(trifluoromethyl)-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 51124557 |
| Molecular Formula | C15H12F3N3O2S2 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 4-[2-(1,3-thiazol-2-ylsulfanyl)propanoyl]-7-(trifluoromethyl)-1,3-dihydroquinoxalin-2-one |
| SMILES | CC(Sc1nccs1)C(=O)N1CC(=O)Nc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C15H12F3N3O2S2/c1-8(25-14-19-4-5-24-14)13(23)21-7-12(22)20-10-6-9(15(16,17)18)2-3-11(10)21/h2-6,8H,7H2,1H3,(H,20,22) |
| InChIKey | CPPWCYXSNSIXKS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|