C22H27N3O4 — CID 51124631
1-[4-[(3,4-dimethoxyphenyl)methylcarbamoyl]phenyl]piperidine-3-carboxamide (PubChem CID 51124631) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is 1-[4-[(3,4-dimethoxyphenyl)methylcarbamoyl]phenyl]piperidine-3-carboxamide.
| Compound Name | 1-[4-[(3,4-dimethoxyphenyl)methylcarbamoyl]phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 51124631 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 1-[4-[(3,4-dimethoxyphenyl)methylcarbamoyl]phenyl]piperidine-3-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2ccc(N3CCCC(C(N)=O)C3)cc2)cc1OC |
| InChI | InChI=1S/C22H27N3O4/c1-28-19-10-5-15(12-20(19)29-2)13-24-22(27)16-6-8-18(9-7-16)25-11-3-4-17(14-25)21(23)26/h5-10,12,17H,3-4,11,13-14H2,1-2H3,(H2,23,26)(H,24,27) |
| InChIKey | UMYBNJCQECFPTP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |