C14H16N4O4S2 — CID 51126323
N-[5-(benzenesulfonamido)-1,3,4-thiadiazol-2-yl]-2-prop-2-enoxypropanamide (PubChem CID 51126323) has the molecular formula C14H16N4O4S2 and a molecular weight of 368.44 g/mol. Its IUPAC name is N-[5-(benzenesulfonamido)-1,3,4-thiadiazol-2-yl]-2-prop-2-enoxypropanamide.
| Compound Name | N-[5-(benzenesulfonamido)-1,3,4-thiadiazol-2-yl]-2-prop-2-enoxypropanamide |
|---|---|
| PubChem CID | 51126323 |
| Molecular Formula | C14H16N4O4S2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | N-[5-(benzenesulfonamido)-1,3,4-thiadiazol-2-yl]-2-prop-2-enoxypropanamide |
| SMILES | C=CCOC(C)C(=O)Nc1nnc(NS(=O)(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C14H16N4O4S2/c1-3-9-22-10(2)12(19)15-13-16-17-14(23-13)18-24(20,21)11-7-5-4-6-8-11/h3-8,10H,1,9H2,2H3,(H,17,18)(H,15,16,19) |
| InChIKey | HYGDEPYUEVSNTE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|