About (5-bromo-2,3-dihydroindol-1-yl)-[3-(tetrazol-1-yl)phenyl]methanone
(5-bromo-2,3-dihydroindol-1-yl)-[3-(tetrazol-1-yl)phenyl]methanone (PubChem CID 51126615) has the molecular formula C16H12BrN5O
and a molecular weight of 370.21 g/mol. Its IUPAC name is (5-bromo-2,3-dihydroindol-1-yl)-[3-(tetrazol-1-yl)phenyl]methanone.
Molecular Properties
| Compound Name | (5-bromo-2,3-dihydroindol-1-yl)-[3-(tetrazol-1-yl)phenyl]methanone |
| PubChem CID | 51126615 |
| Molecular Formula | C16H12BrN5O |
| Molecular Weight | 370.21 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | (5-bromo-2,3-dihydroindol-1-yl)-[3-(tetrazol-1-yl)phenyl]methanone |
| SMILES | O=C(c1cccc(-n2cnnn2)c1)N1CCc2cc(Br)ccc21 |
| InChI | InChI=1S/C16H12BrN5O/c17-13-4-5-15-11(8-13)6-7-21(15)16(23)12-2-1-3-14(9-12)22-10-18-19-20-22/h1-5,8-10H,6-7H2 |
| InChIKey | XUYSHULJEXVZPJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.21 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-bromo-2,3-dihydroindol-1-yl)-[3-(tetrazol-1-yl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-2,3-dihydroindol-1-yl)-[3-(tetrazol-1-yl)phenyl]methanone?
The IUPAC name of (5-bromo-2,3-dihydroindol-1-yl)-[3-(tetrazol-1-yl)phenyl]methanone (CID 51126615) is (5-bromo-2,3-dihydroindol-1-yl)-[3-(tetrazol-1-yl)phenyl]methanone.
What is the SMILES notation for (5-bromo-2,3-dihydroindol-1-yl)-[3-(tetrazol-1-yl)phenyl]methanone?
The canonical SMILES for (5-bromo-2,3-dihydroindol-1-yl)-[3-(tetrazol-1-yl)phenyl]methanone is O=C(c1cccc(-n2cnnn2)c1)N1CCc2cc(Br)ccc21.
What is the InChIKey of (5-bromo-2,3-dihydroindol-1-yl)-[3-(tetrazol-1-yl)phenyl]methanone?
The InChIKey is XUYSHULJEXVZPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BrN5O/c17-13-4-5-15-11(8-13)6-7-21(15)16(23)12-2-1-3-14(9-12)22-10-18-19-20-22/h1-5,8-10H,6-7H2.
What are the key properties of (5-bromo-2,3-dihydroindol-1-yl)-[3-(tetrazol-1-yl)phenyl]methanone?
(5-bromo-2,3-dihydroindol-1-yl)-[3-(tetrazol-1-yl)phenyl]methanone has a molecular weight of 370.21 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-2,3-dihydroindol-1-yl)-[3-(tetrazol-1-yl)phenyl]methanone is sourced from PubChem (CID 51126615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).