C39H50O6 — CID 5112666
[12-benzoyloxy-17-(5-methoxy-5-oxopentan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 5112666) has the molecular formula C39H50O6 and a molecular weight of 614.82 g/mol. Its IUPAC name is [12-benzoyloxy-17-(5-methoxy-5-oxopentan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [12-benzoyloxy-17-(5-methoxy-5-oxopentan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 5112666 |
| Molecular Formula | C39H50O6 |
| Molecular Weight | 614.82 g/mol |
| Exact Mass | 614.36 |
| IUPAC Name | [12-benzoyloxy-17-(5-methoxy-5-oxopentan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | COC(=O)CCC(C)C1CCC2C3CCC4CC(OC(=O)c5ccccc5)CCC4(C)C3CC(OC(=O)c3ccccc3)C12C |
| InChI | InChI=1S/C39H50O6/c1-25(15-20-35(40)43-4)31-18-19-32-30-17-16-28-23-29(44-36(41)26-11-7-5-8-12-26)21-22-38(28,2)33(30)24-34(39(31,32)3)45-37(42)27-13-9-6-10-14-27/h5-14,25,28-34H,15-24H2,1-4H3 |
| InChIKey | KFUKAOONKVKBGZ-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.82 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|