C17H21F3N2O3 — CID 51126733
oxolan-3-yl-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]methanone (PubChem CID 51126733) has the molecular formula C17H21F3N2O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is oxolan-3-yl-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]methanone.
| Compound Name | oxolan-3-yl-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 51126733 |
| Molecular Formula | C17H21F3N2O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | oxolan-3-yl-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]methanone |
| SMILES | O=C(C1CCOC1)N1CCN(Cc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H21F3N2O3/c18-17(19,20)25-15-3-1-13(2-4-15)11-21-6-8-22(9-7-21)16(23)14-5-10-24-12-14/h1-4,14H,5-12H2 |
| InChIKey | CJJXICAXBPAAPW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |