About N-[2-(dimethylamino)ethyl]-N-[(3-fluorophenyl)methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide
N-[2-(dimethylamino)ethyl]-N-[(3-fluorophenyl)methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 51127504) has the molecular formula C16H22FN3O3S
and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-[(3-fluorophenyl)methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-[2-(dimethylamino)ethyl]-N-[(3-fluorophenyl)methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| PubChem CID | 51127504 |
| Molecular Formula | C16H22FN3O3S |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-[(3-fluorophenyl)methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)N(CCN(C)C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C16H22FN3O3S/c1-12-16(13(2)23-18-12)24(21,22)20(9-8-19(3)4)11-14-6-5-7-15(17)10-14/h5-7,10H,8-9,11H2,1-4H3 |
| InChIKey | PUDYFTGGIPZBFG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(dimethylamino)ethyl]-N-[(3-fluorophenyl)methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(dimethylamino)ethyl]-N-[(3-fluorophenyl)methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
The IUPAC name of N-[2-(dimethylamino)ethyl]-N-[(3-fluorophenyl)methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide (CID 51127504) is N-[2-(dimethylamino)ethyl]-N-[(3-fluorophenyl)methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
What is the SMILES notation for N-[2-(dimethylamino)ethyl]-N-[(3-fluorophenyl)methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
The canonical SMILES for N-[2-(dimethylamino)ethyl]-N-[(3-fluorophenyl)methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide is Cc1noc(C)c1S(=O)(=O)N(CCN(C)C)Cc1cccc(F)c1.
What is the InChIKey of N-[2-(dimethylamino)ethyl]-N-[(3-fluorophenyl)methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
The InChIKey is PUDYFTGGIPZBFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22FN3O3S/c1-12-16(13(2)23-18-12)24(21,22)20(9-8-19(3)4)11-14-6-5-7-15(17)10-14/h5-7,10H,8-9,11H2,1-4H3.
What are the key properties of N-[2-(dimethylamino)ethyl]-N-[(3-fluorophenyl)methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
N-[2-(dimethylamino)ethyl]-N-[(3-fluorophenyl)methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide has a molecular weight of 355.44 g/mol, XLogP of 2.18, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(dimethylamino)ethyl]-N-[(3-fluorophenyl)methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide is sourced from PubChem (CID 51127504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).