C17H27N3O3S — CID 51127734
2,4-dimethyl-N-[2-(4-methylpiperidin-1-yl)ethyl]-5-sulfamoylbenzamide (PubChem CID 51127734) has the molecular formula C17H27N3O3S and a molecular weight of 353.49 g/mol. Its IUPAC name is 2,4-dimethyl-N-[2-(4-methylpiperidin-1-yl)ethyl]-5-sulfamoylbenzamide.
| Compound Name | 2,4-dimethyl-N-[2-(4-methylpiperidin-1-yl)ethyl]-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 51127734 |
| Molecular Formula | C17H27N3O3S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 2,4-dimethyl-N-[2-(4-methylpiperidin-1-yl)ethyl]-5-sulfamoylbenzamide |
| SMILES | Cc1cc(C)c(S(N)(=O)=O)cc1C(=O)NCCN1CCC(C)CC1 |
| InChI | InChI=1S/C17H27N3O3S/c1-12-4-7-20(8-5-12)9-6-19-17(21)15-11-16(24(18,22)23)14(3)10-13(15)2/h10-12H,4-9H2,1-3H3,(H,19,21)(H2,18,22,23) |
| InChIKey | LVEOEDHRCSJWQS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |