C18H23F2N3O3 — CID 51128788
N-[2-[[6-(difluoromethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoylamino]ethyl]cyclopropanecarboxamide (PubChem CID 51128788) has the molecular formula C18H23F2N3O3 and a molecular weight of 367.40 g/mol. Its IUPAC name is N-[2-[[6-(difluoromethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoylamino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[6-(difluoromethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoylamino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 51128788 |
| Molecular Formula | C18H23F2N3O3 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | N-[2-[[6-(difluoromethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoylamino]ethyl]cyclopropanecarboxamide |
| SMILES | O=C(NCCNC(=O)C1CC1)NC1CCCc2cc(OC(F)F)ccc21 |
| InChI | InChI=1S/C18H23F2N3O3/c19-17(20)26-13-6-7-14-12(10-13)2-1-3-15(14)23-18(25)22-9-8-21-16(24)11-4-5-11/h6-7,10-11,15,17H,1-5,8-9H2,(H,21,24)(H2,22,23,25) |
| InChIKey | UCWCYMPSPYXRCR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|