C14H15N5O3S3 — CID 51129714
N-(2-methoxyethyl)-5-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methylsulfonyl]-1,3,4-thiadiazol-2-amine (PubChem CID 51129714) has the molecular formula C14H15N5O3S3 and a molecular weight of 397.51 g/mol. Its IUPAC name is N-(2-methoxyethyl)-5-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methylsulfonyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(2-methoxyethyl)-5-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methylsulfonyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 51129714 |
| Molecular Formula | C14H15N5O3S3 |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | N-(2-methoxyethyl)-5-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methylsulfonyl]-1,3,4-thiadiazol-2-amine |
| SMILES | COCCNc1nnc(S(=O)(=O)Cc2csc(-c3ccccn3)n2)s1 |
| InChI | InChI=1S/C14H15N5O3S3/c1-22-7-6-16-13-18-19-14(24-13)25(20,21)9-10-8-23-12(17-10)11-4-2-3-5-15-11/h2-5,8H,6-7,9H2,1H3,(H,16,18) |
| InChIKey | TYIKCBZIJBUUGN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 106.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|