About 3-[4-[2-(4-fluorophenyl)acetyl]piperazine-1-carbonyl]-4,5,5-trimethylfuran-2-one
3-[4-[2-(4-fluorophenyl)acetyl]piperazine-1-carbonyl]-4,5,5-trimethylfuran-2-one (PubChem CID 51129726) has the molecular formula C20H23FN2O4
and a molecular weight of 374.41 g/mol. Its IUPAC name is 3-[4-[2-(4-fluorophenyl)acetyl]piperazine-1-carbonyl]-4,5,5-trimethylfuran-2-one.
Molecular Properties
| Compound Name | 3-[4-[2-(4-fluorophenyl)acetyl]piperazine-1-carbonyl]-4,5,5-trimethylfuran-2-one |
| PubChem CID | 51129726 |
| Molecular Formula | C20H23FN2O4 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 3-[4-[2-(4-fluorophenyl)acetyl]piperazine-1-carbonyl]-4,5,5-trimethylfuran-2-one |
| SMILES | CC1=C(C(=O)N2CCN(C(=O)Cc3ccc(F)cc3)CC2)C(=O)OC1(C)C |
| InChI | InChI=1S/C20H23FN2O4/c1-13-17(19(26)27-20(13,2)3)18(25)23-10-8-22(9-11-23)16(24)12-14-4-6-15(21)7-5-14/h4-7H,8-12H2,1-3H3 |
| InChIKey | QBPPUEAPDIGUHR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[2-(4-fluorophenyl)acetyl]piperazine-1-carbonyl]-4,5,5-trimethylfuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[2-(4-fluorophenyl)acetyl]piperazine-1-carbonyl]-4,5,5-trimethylfuran-2-one?
The IUPAC name of 3-[4-[2-(4-fluorophenyl)acetyl]piperazine-1-carbonyl]-4,5,5-trimethylfuran-2-one (CID 51129726) is 3-[4-[2-(4-fluorophenyl)acetyl]piperazine-1-carbonyl]-4,5,5-trimethylfuran-2-one.
What is the SMILES notation for 3-[4-[2-(4-fluorophenyl)acetyl]piperazine-1-carbonyl]-4,5,5-trimethylfuran-2-one?
The canonical SMILES for 3-[4-[2-(4-fluorophenyl)acetyl]piperazine-1-carbonyl]-4,5,5-trimethylfuran-2-one is CC1=C(C(=O)N2CCN(C(=O)Cc3ccc(F)cc3)CC2)C(=O)OC1(C)C.
What is the InChIKey of 3-[4-[2-(4-fluorophenyl)acetyl]piperazine-1-carbonyl]-4,5,5-trimethylfuran-2-one?
The InChIKey is QBPPUEAPDIGUHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23FN2O4/c1-13-17(19(26)27-20(13,2)3)18(25)23-10-8-22(9-11-23)16(24)12-14-4-6-15(21)7-5-14/h4-7H,8-12H2,1-3H3.
What are the key properties of 3-[4-[2-(4-fluorophenyl)acetyl]piperazine-1-carbonyl]-4,5,5-trimethylfuran-2-one?
3-[4-[2-(4-fluorophenyl)acetyl]piperazine-1-carbonyl]-4,5,5-trimethylfuran-2-one has a molecular weight of 374.41 g/mol, XLogP of 1.69, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[2-(4-fluorophenyl)acetyl]piperazine-1-carbonyl]-4,5,5-trimethylfuran-2-one is sourced from PubChem (CID 51129726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).